C23H38B — CID 159833518
CID 159833518 (PubChem CID 159833518) has the molecular formula C23H38B and a molecular weight of 325.37 g/mol.
| Compound Name | CID 159833518 |
|---|---|
| PubChem CID | 159833518 |
| Molecular Formula | C23H38B |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.31 |
| IUPAC Name | — |
| SMILES | C=C=CC=C.C=CCCCC(C)C=C.C=CCCCC=CCC.[B] |
| InChI | InChI=1S/2C9H16.C5H6.B/c1-4-6-7-8-9(3)5-2;1-3-5-7-9-8-6-4-2;1-3-5-4-2;/h4-5,9H,1-2,6-8H2,3H3;3,6,8H,1,4-5,7,9H2,2H3;3,5H,1-2H2; |
| InChIKey | SVWAJXXQFWQTLQ-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|