C26H46 — CID 177270175
(3E,8E,15E,20E)-12-propan-2-yltricosa-3,8,15,20-tetraene (PubChem CID 177270175) has the molecular formula C26H46 and a molecular weight of 358.65 g/mol. Its IUPAC name is (3E,8E,15E,20E)-12-propan-2-yltricosa-3,8,15,20-tetraene.
| Compound Name | (3E,8E,15E,20E)-12-propan-2-yltricosa-3,8,15,20-tetraene |
|---|---|
| PubChem CID | 177270175 |
| Molecular Formula | C26H46 |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 358.36 |
| IUPAC Name | (3E,8E,15E,20E)-12-propan-2-yltricosa-3,8,15,20-tetraene |
| SMILES | CC/C=C/CCC/C=C/CCC(CC/C=C/CCC/C=C/CC)C(C)C |
| InChI | InChI=1S/C26H46/c1-5-7-9-11-13-15-17-19-21-23-26(25(3)4)24-22-20-18-16-14-12-10-8-6-2/h7-10,17-20,25-26H,5-6,11-16,21-24H2,1-4H3/b9-7+,10-8+,19-17+,20-18+ |
| InChIKey | XWKDHSPWZUJTGE-WVFITRLNSA-N |
| XLogP | 9.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|