C42H78 — CID 177270192
(10E,16E,23E,29E)-20-propan-2-ylnonatriaconta-10,16,23,29-tetraene (PubChem CID 177270192) has the molecular formula C42H78 and a molecular weight of 583.09 g/mol. Its IUPAC name is (10E,16E,23E,29E)-20-propan-2-ylnonatriaconta-10,16,23,29-tetraene.
| Compound Name | (10E,16E,23E,29E)-20-propan-2-ylnonatriaconta-10,16,23,29-tetraene |
|---|---|
| PubChem CID | 177270192 |
| Molecular Formula | C42H78 |
| Molecular Weight | 583.09 g/mol |
| Exact Mass | 582.61 |
| IUPAC Name | (10E,16E,23E,29E)-20-propan-2-ylnonatriaconta-10,16,23,29-tetraene |
| SMILES | CCCCCCCCC/C=C/CCCC/C=C/CCC(CC/C=C/CCCC/C=C/CCCCCCCCC)C(C)C |
| InChI | InChI=1S/C42H78/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-42(41(3)4)40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h21-24,33-36,41-42H,5-20,25-32,37-40H2,1-4H3/b23-21+,24-22+,35-33+,36-34+ |
| InChIKey | NHEMRZHJGNFZFW-HLQBZXBKSA-N |
| XLogP | 15.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 33 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.09 |
| LogP ≤ 5 | 15.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|