C38H70 — CID 177270133
(2E,14E,21E,33E)-18-propan-2-ylpentatriaconta-2,14,21,33-tetraene (PubChem CID 177270133) has the molecular formula C38H70 and a molecular weight of 526.98 g/mol. Its IUPAC name is (2E,14E,21E,33E)-18-propan-2-ylpentatriaconta-2,14,21,33-tetraene.
| Compound Name | (2E,14E,21E,33E)-18-propan-2-ylpentatriaconta-2,14,21,33-tetraene |
|---|---|
| PubChem CID | 177270133 |
| Molecular Formula | C38H70 |
| Molecular Weight | 526.98 g/mol |
| Exact Mass | 526.55 |
| IUPAC Name | (2E,14E,21E,33E)-18-propan-2-ylpentatriaconta-2,14,21,33-tetraene |
| SMILES | C/C=C/CCCCCCCCCC/C=C/CCC(CC/C=C/CCCCCCCCCC/C=C/C)C(C)C |
| InChI | InChI=1S/C38H70/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38(37(3)4)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h5-8,29-32,37-38H,9-28,33-36H2,1-4H3/b7-5+,8-6+,31-29+,32-30+ |
| InChIKey | OIWZMXMTSQTHPG-PLJUUKDESA-N |
| XLogP | 13.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 29 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.98 |
| LogP ≤ 5 | 13.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|