About 8-ethenyldocosan-7-one
8-ethenyldocosan-7-one (PubChem CID 142765848) has the molecular formula C24H46O
and a molecular weight of 350.63 g/mol. Its IUPAC name is 8-ethenyldocosan-7-one.
Molecular Properties
| Compound Name | 8-ethenyldocosan-7-one |
| PubChem CID | 142765848 |
| Molecular Formula | C24H46O |
| Molecular Weight | 350.63 g/mol |
| Exact Mass | 350.35 |
| IUPAC Name | 8-ethenyldocosan-7-one |
| SMILES | C=CC(CCCCCCCCCCCCCC)C(=O)CCCCCC |
| InChI | InChI=1S/C24H46O/c1-4-7-9-11-12-13-14-15-16-17-18-19-21-23(6-3)24(25)22-20-10-8-5-2/h6,23H,3-5,7-22H2,1-2H3 |
| InChIKey | MYWPZSYRUDLOQD-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.63 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-ethenyldocosan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethenyldocosan-7-one?
The IUPAC name of 8-ethenyldocosan-7-one (CID 142765848) is 8-ethenyldocosan-7-one.
What is the SMILES notation for 8-ethenyldocosan-7-one?
The canonical SMILES for 8-ethenyldocosan-7-one is C=CC(CCCCCCCCCCCCCC)C(=O)CCCCCC.
What is the InChIKey of 8-ethenyldocosan-7-one?
The InChIKey is MYWPZSYRUDLOQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46O/c1-4-7-9-11-12-13-14-15-16-17-18-19-21-23(6-3)24(25)22-20-10-8-5-2/h6,23H,3-5,7-22H2,1-2H3.
What are the key properties of 8-ethenyldocosan-7-one?
8-ethenyldocosan-7-one has a molecular weight of 350.63 g/mol, XLogP of 8.42, 20 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethenyldocosan-7-one is sourced from PubChem (CID 142765848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).