About 3-ethenylnonan-2-one;nonadecan-2-one
3-ethenylnonan-2-one;nonadecan-2-one (PubChem CID 159197887) has the molecular formula C30H58O2
and a molecular weight of 450.79 g/mol. Its IUPAC name is 3-ethenylnonan-2-one;nonadecan-2-one.
Molecular Properties
| Compound Name | 3-ethenylnonan-2-one;nonadecan-2-one |
| PubChem CID | 159197887 |
| Molecular Formula | C30H58O2 |
| Molecular Weight | 450.79 g/mol |
| Exact Mass | 450.44 |
| IUPAC Name | 3-ethenylnonan-2-one;nonadecan-2-one |
| SMILES | C=CC(CCCCCC)C(C)=O.CCCCCCCCCCCCCCCCCC(C)=O |
| InChI | InChI=1S/C19H38O.C11H20O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)20;1-4-6-7-8-9-11(5-2)10(3)12/h3-18H2,1-2H3;5,11H,2,4,6-9H2,1,3H3 |
| InChIKey | KOWZKVNMYZJIOH-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.79 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenylnonan-2-one;nonadecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenylnonan-2-one;nonadecan-2-one?
The IUPAC name of 3-ethenylnonan-2-one;nonadecan-2-one (CID 159197887) is 3-ethenylnonan-2-one;nonadecan-2-one.
What is the SMILES notation for 3-ethenylnonan-2-one;nonadecan-2-one?
The canonical SMILES for 3-ethenylnonan-2-one;nonadecan-2-one is C=CC(CCCCCC)C(C)=O.CCCCCCCCCCCCCCCCCC(C)=O.
What is the InChIKey of 3-ethenylnonan-2-one;nonadecan-2-one?
The InChIKey is KOWZKVNMYZJIOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O.C11H20O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)20;1-4-6-7-8-9-11(5-2)10(3)12/h3-18H2,1-2H3;5,11H,2,4,6-9H2,1,3H3.
What are the key properties of 3-ethenylnonan-2-one;nonadecan-2-one?
3-ethenylnonan-2-one;nonadecan-2-one has a molecular weight of 450.79 g/mol, XLogP of 10.18, 23 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenylnonan-2-one;nonadecan-2-one is sourced from PubChem (CID 159197887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).