C12H23N — CID 126514852
(3E)-2-ethyl-3-prop-2-enylideneheptan-1-amine (PubChem CID 126514852) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (3E)-2-ethyl-3-prop-2-enylideneheptan-1-amine.
| Compound Name | (3E)-2-ethyl-3-prop-2-enylideneheptan-1-amine |
|---|---|
| PubChem CID | 126514852 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (3E)-2-ethyl-3-prop-2-enylideneheptan-1-amine |
| SMILES | C=C/C=C(\CCCC)C(CC)CN |
| InChI | InChI=1S/C12H23N/c1-4-7-9-12(8-5-2)11(6-3)10-13/h5,8,11H,2,4,6-7,9-10,13H2,1,3H3/b12-8+ |
| InChIKey | DVVDGGPEZPOENK-XYOKQWHBSA-N |
| XLogP | 3.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|