C17H31P — CID 123581563
(5-ethyl-3-methylocta-5,7-dien-2-yl)-hex-1-en-2-ylphosphane (PubChem CID 123581563) has the molecular formula C17H31P and a molecular weight of 266.41 g/mol. Its IUPAC name is (5-ethyl-3-methylocta-5,7-dien-2-yl)-hex-1-en-2-ylphosphane.
| Compound Name | (5-ethyl-3-methylocta-5,7-dien-2-yl)-hex-1-en-2-ylphosphane |
|---|---|
| PubChem CID | 123581563 |
| Molecular Formula | C17H31P |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (5-ethyl-3-methylocta-5,7-dien-2-yl)-hex-1-en-2-ylphosphane |
| SMILES | C=CC=C(CC)CC(C)C(C)PC(=C)CCCC |
| InChI | InChI=1S/C17H31P/c1-7-10-12-15(5)18-16(6)14(4)13-17(9-3)11-8-2/h8,11,14,16,18H,2,5,7,9-10,12-13H2,1,3-4,6H3 |
| InChIKey | YRUBJLDJBLFOMK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|