C13H28 — CID 143713384
ethane;(3E)-4-ethyl-5-methylhexa-1,3-diene (PubChem CID 143713384) has the molecular formula C13H28 and a molecular weight of 184.37 g/mol. Its IUPAC name is ethane;(3E)-4-ethyl-5-methylhexa-1,3-diene.
| Compound Name | ethane;(3E)-4-ethyl-5-methylhexa-1,3-diene |
|---|---|
| PubChem CID | 143713384 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | ethane;(3E)-4-ethyl-5-methylhexa-1,3-diene |
| SMILES | C=C/C=C(\CC)C(C)C.CC.CC |
| InChI | InChI=1S/C9H16.2C2H6/c1-5-7-9(6-2)8(3)4;2*1-2/h5,7-8H,1,6H2,2-4H3;2*1-2H3/b9-7+;; |
| InChIKey | TWBCUBGUEDJUGG-OJYIHNBOSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|