C10H16O — CID 170052776
(1E,4E)-4-propan-2-ylhepta-1,4,6-trien-1-ol (PubChem CID 170052776) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (1E,4E)-4-propan-2-ylhepta-1,4,6-trien-1-ol.
| Compound Name | (1E,4E)-4-propan-2-ylhepta-1,4,6-trien-1-ol |
|---|---|
| PubChem CID | 170052776 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (1E,4E)-4-propan-2-ylhepta-1,4,6-trien-1-ol |
| SMILES | C=C/C=C(\C/C=C/O)C(C)C |
| InChI | InChI=1S/C10H16O/c1-4-6-10(9(2)3)7-5-8-11/h4-6,8-9,11H,1,7H2,2-3H3/b8-5+,10-6+ |
| InChIKey | XPNBIMOYPYOJIO-YLDLMLGBSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|