C8H15N — CID 149492466
(3E)-3-ethylhexa-3,5-dien-2-amine (PubChem CID 149492466) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is (3E)-3-ethylhexa-3,5-dien-2-amine.
| Compound Name | (3E)-3-ethylhexa-3,5-dien-2-amine |
|---|---|
| PubChem CID | 149492466 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (3E)-3-ethylhexa-3,5-dien-2-amine |
| SMILES | C=C/C=C(\CC)C(C)N |
| InChI | InChI=1S/C8H15N/c1-4-6-8(5-2)7(3)9/h4,6-7H,1,5,9H2,2-3H3/b8-6+ |
| InChIKey | ZFJKYJMAKBJNIO-SOFGYWHQSA-N |
| XLogP | 1.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|