C11H22N2 — CID 143109979
ethene;(3E)-3-ethyl-2-N-methylhexa-3,5-diene-1,2-diamine (PubChem CID 143109979) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is ethene;(3E)-3-ethyl-2-N-methylhexa-3,5-diene-1,2-diamine.
| Compound Name | ethene;(3E)-3-ethyl-2-N-methylhexa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 143109979 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | ethene;(3E)-3-ethyl-2-N-methylhexa-3,5-diene-1,2-diamine |
| SMILES | C=C.C=C/C=C(\CC)C(CN)NC |
| InChI | InChI=1S/C9H18N2.C2H4/c1-4-6-8(5-2)9(7-10)11-3;1-2/h4,6,9,11H,1,5,7,10H2,2-3H3;1-2H2/b8-6+; |
| InChIKey | NHIVYKBHCXLCIG-WVLIHFOGSA-N |
| XLogP | 1.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|