About (3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine
(3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine (PubChem CID 143109843) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is (3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine.
Molecular Properties
| Compound Name | (3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine |
| PubChem CID | 143109843 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine |
| SMILES | C=C/C=C(\C=C)C(CN)NC |
| InChI | InChI=1S/C9H16N2/c1-4-6-8(5-2)9(7-10)11-3/h4-6,9,11H,1-2,7,10H2,3H3/b8-6+ |
| InChIKey | JWJLEAOKFJAJPF-SOFGYWHQSA-N |
| XLogP | 0.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine?
The IUPAC name of (3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine (CID 143109843) is (3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine.
What is the SMILES notation for (3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine?
The canonical SMILES for (3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine is C=C/C=C(\C=C)C(CN)NC.
What is the InChIKey of (3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine?
The InChIKey is JWJLEAOKFJAJPF-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H16N2/c1-4-6-8(5-2)9(7-10)11-3/h4-6,9,11H,1-2,7,10H2,3H3/b8-6+.
What are the key properties of (3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine?
(3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine has a molecular weight of 152.24 g/mol, XLogP of 0.83, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine is sourced from PubChem (CID 143109843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).