C9H16N2 — CID 143109843
(3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine (PubChem CID 143109843) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine.
| Compound Name | (3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 143109843 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (3E)-3-ethenyl-2-N-methylhexa-3,5-diene-1,2-diamine |
| SMILES | C=C/C=C(\C=C)C(CN)NC |
| InChI | InChI=1S/C9H16N2/c1-4-6-8(5-2)9(7-10)11-3/h4-6,9,11H,1-2,7,10H2,3H3/b8-6+ |
| InChIKey | JWJLEAOKFJAJPF-SOFGYWHQSA-N |
| XLogP | 0.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|