C11H17N — CID 123221965
4-ethenyl-N-methylocta-4,6,7-trien-3-amine (PubChem CID 123221965) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 4-ethenyl-N-methylocta-4,6,7-trien-3-amine.
| Compound Name | 4-ethenyl-N-methylocta-4,6,7-trien-3-amine |
|---|---|
| PubChem CID | 123221965 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 4-ethenyl-N-methylocta-4,6,7-trien-3-amine |
| SMILES | C=C=CC=C(C=C)C(CC)NC |
| InChI | InChI=1S/C11H17N/c1-5-8-9-10(6-2)11(7-3)12-4/h6,8-9,11-12H,1-2,7H2,3-4H3 |
| InChIKey | WVNBQOAUQCBNCQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|