C11H20N2O — CID 123741995
(2R,3R)-2-amino-1-(dimethylamino)-4-ethenylhepta-4,6-dien-3-ol (PubChem CID 123741995) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is (2R,3R)-2-amino-1-(dimethylamino)-4-ethenylhepta-4,6-dien-3-ol.
| Compound Name | (2R,3R)-2-amino-1-(dimethylamino)-4-ethenylhepta-4,6-dien-3-ol |
|---|---|
| PubChem CID | 123741995 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (2R,3R)-2-amino-1-(dimethylamino)-4-ethenylhepta-4,6-dien-3-ol |
| SMILES | C=CC=C(C=C)[C@@H](O)[C@H](N)CN(C)C |
| InChI | InChI=1S/C11H20N2O/c1-5-7-9(6-2)11(14)10(12)8-13(3)4/h5-7,10-11,14H,1-2,8,12H2,3-4H3/t10-,11-/m1/s1 |
| InChIKey | GVLLMUCOQAWMGS-GHMZBOCLSA-N |
| XLogP | 0.53 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|