C9H15NO — CID 177168631
(2R,3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol (PubChem CID 177168631) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (2R,3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol.
| Compound Name | (2R,3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 177168631 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (2R,3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol |
| SMILES | C=C/C=C(\C=C)[C@@H](O)CNC |
| InChI | InChI=1S/C9H15NO/c1-4-6-8(5-2)9(11)7-10-3/h4-6,9-11H,1-2,7H2,3H3/b8-6+/t9-/m0/s1 |
| InChIKey | DMUASIWIXOULOH-ORZBULNSSA-N |
| XLogP | 0.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|