C10H18O2 — CID 145139860
ethane;(3E)-3-ethenylhexa-3,5-diene-1,2-diol (PubChem CID 145139860) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is ethane;(3E)-3-ethenylhexa-3,5-diene-1,2-diol.
| Compound Name | ethane;(3E)-3-ethenylhexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 145139860 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | ethane;(3E)-3-ethenylhexa-3,5-diene-1,2-diol |
| SMILES | C=C/C=C(\C=C)C(O)CO.CC |
| InChI | InChI=1S/C8H12O2.C2H6/c1-3-5-7(4-2)8(10)6-9;1-2/h3-5,8-10H,1-2,6H2;1-2H3/b7-5+; |
| InChIKey | XWIZTQJAPGNGHJ-GZOLSCHFSA-N |
| XLogP | 1.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|