C11H17NO2 — CID 142183456
N-[(3S,4E)-4-ethenyl-1-hydroxyhepta-4,6-dien-3-yl]acetamide (PubChem CID 142183456) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is N-[(3S,4E)-4-ethenyl-1-hydroxyhepta-4,6-dien-3-yl]acetamide.
| Compound Name | N-[(3S,4E)-4-ethenyl-1-hydroxyhepta-4,6-dien-3-yl]acetamide |
|---|---|
| PubChem CID | 142183456 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-[(3S,4E)-4-ethenyl-1-hydroxyhepta-4,6-dien-3-yl]acetamide |
| SMILES | C=C/C=C(\C=C)[C@H](CCO)NC(C)=O |
| InChI | InChI=1S/C11H17NO2/c1-4-6-10(5-2)11(7-8-13)12-9(3)14/h4-6,11,13H,1-2,7-8H2,3H3,(H,12,14)/b10-6+/t11-/m0/s1 |
| InChIKey | VNZHXUHXJDCGOF-RUYJGKKWSA-N |
| XLogP | 1.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|