C8H14N2O2 — CID 88635946
N-(1-acetamidobut-3-enyl)acetamide (PubChem CID 88635946) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is N-(1-acetamidobut-3-enyl)acetamide.
| Compound Name | N-(1-acetamidobut-3-enyl)acetamide |
|---|---|
| PubChem CID | 88635946 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | N-(1-acetamidobut-3-enyl)acetamide |
| SMILES | C=CCC(NC(C)=O)NC(C)=O |
| InChI | InChI=1S/C8H14N2O2/c1-4-5-8(9-6(2)11)10-7(3)12/h4,8H,1,5H2,2-3H3,(H,9,11)(H,10,12) |
| InChIKey | WEYKGCUESTUGNX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|