C8H15NO3 — CID 174926163
N-(2,3-dihydroxyhex-5-enyl)acetamide (PubChem CID 174926163) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is N-(2,3-dihydroxyhex-5-enyl)acetamide.
| Compound Name | N-(2,3-dihydroxyhex-5-enyl)acetamide |
|---|---|
| PubChem CID | 174926163 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | N-(2,3-dihydroxyhex-5-enyl)acetamide |
| SMILES | C=CCC(O)C(O)CNC(C)=O |
| InChI | InChI=1S/C8H15NO3/c1-3-4-7(11)8(12)5-9-6(2)10/h3,7-8,11-12H,1,4-5H2,2H3,(H,9,10) |
| InChIKey | IODRTLUDGXNRDE-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|