C9H12INO2 — CID 142080079
N-[(2R,3E)-3-ethenyl-1-hydroxyhexa-3,5-dien-2-yl]carbamoyl iodide (PubChem CID 142080079) has the molecular formula C9H12INO2 and a molecular weight of 293.10 g/mol. Its IUPAC name is N-[(2R,3E)-3-ethenyl-1-hydroxyhexa-3,5-dien-2-yl]carbamoyl iodide.
| Compound Name | N-[(2R,3E)-3-ethenyl-1-hydroxyhexa-3,5-dien-2-yl]carbamoyl iodide |
|---|---|
| PubChem CID | 142080079 |
| Molecular Formula | C9H12INO2 |
| Molecular Weight | 293.10 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | N-[(2R,3E)-3-ethenyl-1-hydroxyhexa-3,5-dien-2-yl]carbamoyl iodide |
| SMILES | C=C/C=C(\C=C)[C@H](CO)NC(=O)I |
| InChI | InChI=1S/C9H12INO2/c1-3-5-7(4-2)8(6-12)11-9(10)13/h3-5,8,12H,1-2,6H2,(H,11,13)/b7-5+/t8-/m0/s1 |
| InChIKey | NFJXSPNZZJBNFS-IVGLGHLBSA-N |
| XLogP | 1.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.10 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|