C23H42N2O2 — CID 145300688
1,3-dimethylcyclohexane;N-[(3E)-3-ethenyl-1-formamidohexa-3,5-dien-2-yl]propanamide;propane (PubChem CID 145300688) has the molecular formula C23H42N2O2 and a molecular weight of 378.60 g/mol. Its IUPAC name is 1,3-dimethylcyclohexane;N-[(3E)-3-ethenyl-1-formamidohexa-3,5-dien-2-yl]propanamide;propane.
| Compound Name | 1,3-dimethylcyclohexane;N-[(3E)-3-ethenyl-1-formamidohexa-3,5-dien-2-yl]propanamide;propane |
|---|---|
| PubChem CID | 145300688 |
| Molecular Formula | C23H42N2O2 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.32 |
| IUPAC Name | 1,3-dimethylcyclohexane;N-[(3E)-3-ethenyl-1-formamidohexa-3,5-dien-2-yl]propanamide;propane |
| SMILES | C=C/C=C(\C=C)C(CNC=O)NC(=O)CC.CC1CCCC(C)C1.CCC |
| InChI | InChI=1S/C12H18N2O2.C8H16.C3H8/c1-4-7-10(5-2)11(8-13-9-15)14-12(16)6-3;1-7-4-3-5-8(2)6-7;1-3-2/h4-5,7,9,11H,1-2,6,8H2,3H3,(H,13,15)(H,14,16);7-8H,3-6H2,1-2H3;3H2,1-2H3/b10-7+;; |
| InChIKey | CJLXIDJNUNLGOH-WRQJSNHTSA-N |
| XLogP | 5.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|