C13H26O4 — CID 143971653
(3-methylcyclohexyl) 2,3-dihydroxypropanoate;propane (PubChem CID 143971653) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is (3-methylcyclohexyl) 2,3-dihydroxypropanoate;propane.
| Compound Name | (3-methylcyclohexyl) 2,3-dihydroxypropanoate;propane |
|---|---|
| PubChem CID | 143971653 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | (3-methylcyclohexyl) 2,3-dihydroxypropanoate;propane |
| SMILES | CC1CCCC(OC(=O)C(O)CO)C1.CCC |
| InChI | InChI=1S/C10H18O4.C3H8/c1-7-3-2-4-8(5-7)14-10(13)9(12)6-11;1-3-2/h7-9,11-12H,2-6H2,1H3;3H2,1-2H3 |
| InChIKey | GNWNCVHWYXWBDQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |