About (3-methylcyclohexyl) (2R)-2-amino-3-hydroxypropanoate
(3-methylcyclohexyl) (2R)-2-amino-3-hydroxypropanoate (PubChem CID 80751175) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is (3-methylcyclohexyl) (2R)-2-amino-3-hydroxypropanoate.
Molecular Properties
| Compound Name | (3-methylcyclohexyl) (2R)-2-amino-3-hydroxypropanoate |
| PubChem CID | 80751175 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (3-methylcyclohexyl) (2R)-2-amino-3-hydroxypropanoate |
| SMILES | CC1CCCC(OC(=O)[C@H](N)CO)C1 |
| InChI | InChI=1S/C10H19NO3/c1-7-3-2-4-8(5-7)14-10(13)9(11)6-12/h7-9,12H,2-6,11H2,1H3/t7?,8?,9-/m1/s1 |
| InChIKey | FGDBULVLQMTOOV-AMDVSUOASA-N |
| XLogP | 0.43 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methylcyclohexyl) (2R)-2-amino-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylcyclohexyl) (2R)-2-amino-3-hydroxypropanoate?
The IUPAC name of (3-methylcyclohexyl) (2R)-2-amino-3-hydroxypropanoate (CID 80751175) is (3-methylcyclohexyl) (2R)-2-amino-3-hydroxypropanoate.
What is the SMILES notation for (3-methylcyclohexyl) (2R)-2-amino-3-hydroxypropanoate?
The canonical SMILES for (3-methylcyclohexyl) (2R)-2-amino-3-hydroxypropanoate is CC1CCCC(OC(=O)[C@H](N)CO)C1.
What is the InChIKey of (3-methylcyclohexyl) (2R)-2-amino-3-hydroxypropanoate?
The InChIKey is FGDBULVLQMTOOV-AMDVSUOASA-N. The full InChI is InChI=1S/C10H19NO3/c1-7-3-2-4-8(5-7)14-10(13)9(11)6-12/h7-9,12H,2-6,11H2,1H3/t7?,8?,9-/m1/s1.
What are the key properties of (3-methylcyclohexyl) (2R)-2-amino-3-hydroxypropanoate?
(3-methylcyclohexyl) (2R)-2-amino-3-hydroxypropanoate has a molecular weight of 201.27 g/mol, XLogP of 0.43, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylcyclohexyl) (2R)-2-amino-3-hydroxypropanoate is sourced from PubChem (CID 80751175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).