C13H28O2 — CID 168973944
2-[(3R)-3-methylcyclohexyl]propane-1,3-diol;propane (PubChem CID 168973944) has the molecular formula C13H28O2 and a molecular weight of 216.36 g/mol. Its IUPAC name is 2-[(3R)-3-methylcyclohexyl]propane-1,3-diol;propane.
| Compound Name | 2-[(3R)-3-methylcyclohexyl]propane-1,3-diol;propane |
|---|---|
| PubChem CID | 168973944 |
| Molecular Formula | C13H28O2 |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.21 |
| IUPAC Name | 2-[(3R)-3-methylcyclohexyl]propane-1,3-diol;propane |
| SMILES | CCC.C[C@@H]1CCCC(C(CO)CO)C1 |
| InChI | InChI=1S/C10H20O2.C3H8/c1-8-3-2-4-9(5-8)10(6-11)7-12;1-3-2/h8-12H,2-7H2,1H3;3H2,1-2H3/t8-,9?;/m1./s1 |
| InChIKey | OHTJEHFQLXERBB-URIXSHMWSA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |