C13H26O2 — CID 103449271
2-ethyl-1-(3-methylcyclohexyl)butane-1,2-diol (PubChem CID 103449271) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-ethyl-1-(3-methylcyclohexyl)butane-1,2-diol.
| Compound Name | 2-ethyl-1-(3-methylcyclohexyl)butane-1,2-diol |
|---|---|
| PubChem CID | 103449271 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 2-ethyl-1-(3-methylcyclohexyl)butane-1,2-diol |
| SMILES | CCC(O)(CC)C(O)C1CCCC(C)C1 |
| InChI | InChI=1S/C13H26O2/c1-4-13(15,5-2)12(14)11-8-6-7-10(3)9-11/h10-12,14-15H,4-9H2,1-3H3 |
| InChIKey | FIAJDXKTGAKYSP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |