About ethane;(3-methylcyclohexyl) 2-(dimethylamino)acetate;propane
ethane;(3-methylcyclohexyl) 2-(dimethylamino)acetate;propane (PubChem CID 156718776) has the molecular formula C16H35NO2
and a molecular weight of 273.46 g/mol. Its IUPAC name is ethane;(3-methylcyclohexyl) 2-(dimethylamino)acetate;propane.
Molecular Properties
| Compound Name | ethane;(3-methylcyclohexyl) 2-(dimethylamino)acetate;propane |
| PubChem CID | 156718776 |
| Molecular Formula | C16H35NO2 |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.27 |
| IUPAC Name | ethane;(3-methylcyclohexyl) 2-(dimethylamino)acetate;propane |
| SMILES | CC.CC1CCCC(OC(=O)CN(C)C)C1.CCC |
| InChI | InChI=1S/C11H21NO2.C3H8.C2H6/c1-9-5-4-6-10(7-9)14-11(13)8-12(2)3;1-3-2;1-2/h9-10H,4-8H2,1-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | QISRIOGJLUVDMO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;(3-methylcyclohexyl) 2-(dimethylamino)acetate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3-methylcyclohexyl) 2-(dimethylamino)acetate;propane?
The IUPAC name of ethane;(3-methylcyclohexyl) 2-(dimethylamino)acetate;propane (CID 156718776) is ethane;(3-methylcyclohexyl) 2-(dimethylamino)acetate;propane.
What is the SMILES notation for ethane;(3-methylcyclohexyl) 2-(dimethylamino)acetate;propane?
The canonical SMILES for ethane;(3-methylcyclohexyl) 2-(dimethylamino)acetate;propane is CC.CC1CCCC(OC(=O)CN(C)C)C1.CCC.
What is the InChIKey of ethane;(3-methylcyclohexyl) 2-(dimethylamino)acetate;propane?
The InChIKey is QISRIOGJLUVDMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2.C3H8.C2H6/c1-9-5-4-6-10(7-9)14-11(13)8-12(2)3;1-3-2;1-2/h9-10H,4-8H2,1-3H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;(3-methylcyclohexyl) 2-(dimethylamino)acetate;propane?
ethane;(3-methylcyclohexyl) 2-(dimethylamino)acetate;propane has a molecular weight of 273.46 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3-methylcyclohexyl) 2-(dimethylamino)acetate;propane is sourced from PubChem (CID 156718776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).