About N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane
N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane (PubChem CID 143474945) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane.
Molecular Properties
| Compound Name | N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane |
| PubChem CID | 143474945 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane |
| SMILES | C=C/C=C(\C=C)NC(=O)CC.CCC |
| InChI | InChI=1S/C9H13NO.C3H8/c1-4-7-8(5-2)10-9(11)6-3;1-3-2/h4-5,7H,1-2,6H2,3H3,(H,10,11);3H2,1-2H3/b8-7+; |
| InChIKey | PAFGICQKMBPXDE-USRGLUTNSA-N |
| XLogP | 3.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane?
The IUPAC name of N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane (CID 143474945) is N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane.
What is the SMILES notation for N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane?
The canonical SMILES for N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane is C=C/C=C(\C=C)NC(=O)CC.CCC.
What is the InChIKey of N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane?
The InChIKey is PAFGICQKMBPXDE-USRGLUTNSA-N. The full InChI is InChI=1S/C9H13NO.C3H8/c1-4-7-8(5-2)10-9(11)6-3;1-3-2/h4-5,7H,1-2,6H2,3H3,(H,10,11);3H2,1-2H3/b8-7+;.
What are the key properties of N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane?
N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane has a molecular weight of 195.31 g/mol, XLogP of 3.18, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane is sourced from PubChem (CID 143474945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).