C12H21NO — CID 143474945
N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane (PubChem CID 143474945) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane.
| Compound Name | N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane |
|---|---|
| PubChem CID | 143474945 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;propane |
| SMILES | C=C/C=C(\C=C)NC(=O)CC.CCC |
| InChI | InChI=1S/C9H13NO.C3H8/c1-4-7-8(5-2)10-9(11)6-3;1-3-2/h4-5,7H,1-2,6H2,3H3,(H,10,11);3H2,1-2H3/b8-7+; |
| InChIKey | PAFGICQKMBPXDE-USRGLUTNSA-N |
| XLogP | 3.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|