C7H10N2O — CID 143228458
[(3E)-hexa-1,3,5-trien-3-yl]urea (PubChem CID 143228458) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is [(3E)-hexa-1,3,5-trien-3-yl]urea.
| Compound Name | [(3E)-hexa-1,3,5-trien-3-yl]urea |
|---|---|
| PubChem CID | 143228458 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | [(3E)-hexa-1,3,5-trien-3-yl]urea |
| SMILES | C=C/C=C(\C=C)NC(N)=O |
| InChI | InChI=1S/C7H10N2O/c1-3-5-6(4-2)9-7(8)10/h3-5H,1-2H2,(H3,8,9,10)/b6-5+ |
| InChIKey | URWQQGWBJPRCGE-AATRIKPKSA-N |
| XLogP | 0.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|