C9H15NO — CID 143474971
N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;molecular hydrogen (PubChem CID 143474971) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;molecular hydrogen.
| Compound Name | N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 143474971 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N-[(3E)-hexa-1,3,5-trien-3-yl]propanamide;molecular hydrogen |
| SMILES | C=C/C=C(\C=C)NC(=O)CC.[H][H] |
| InChI | InChI=1S/C9H13NO.H2/c1-4-7-8(5-2)10-9(11)6-3;/h4-5,7H,1-2,6H2,3H3,(H,10,11);1H/b8-7+; |
| InChIKey | ZRJGEXGZGUMNBI-USRGLUTNSA-N |
| XLogP | 2.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|