C12H19NO — CID 146639754
N-[(2E,4Z)-5-ethylhepta-2,4,6-trien-2-yl]propanamide (PubChem CID 146639754) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N-[(2E,4Z)-5-ethylhepta-2,4,6-trien-2-yl]propanamide.
| Compound Name | N-[(2E,4Z)-5-ethylhepta-2,4,6-trien-2-yl]propanamide |
|---|---|
| PubChem CID | 146639754 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-[(2E,4Z)-5-ethylhepta-2,4,6-trien-2-yl]propanamide |
| SMILES | C=C/C(=C\C=C(/C)NC(=O)CC)CC |
| InChI | InChI=1S/C12H19NO/c1-5-11(6-2)9-8-10(4)13-12(14)7-3/h5,8-9H,1,6-7H2,2-4H3,(H,13,14)/b10-8+,11-9+ |
| InChIKey | MAGBXJCVMKNVRL-GFULKKFKSA-N |
| XLogP | 2.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|