C9H14FNO — CID 143108414
N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide (PubChem CID 143108414) has the molecular formula C9H14FNO and a molecular weight of 171.21 g/mol. Its IUPAC name is N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide.
| Compound Name | N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide |
|---|---|
| PubChem CID | 143108414 |
| Molecular Formula | C9H14FNO |
| Molecular Weight | 171.21 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide |
| SMILES | CCC(=O)N/C(C)=C/C=C(\C)F |
| InChI | InChI=1S/C9H14FNO/c1-4-9(12)11-8(3)6-5-7(2)10/h5-6H,4H2,1-3H3,(H,11,12)/b7-5+,8-6+ |
| InChIKey | ZSYCNZXRZQGCFN-KQQUZDAGSA-N |
| XLogP | 2.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|