About N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide
N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide (PubChem CID 143108414) has the molecular formula C9H14FNO
and a molecular weight of 171.21 g/mol. Its IUPAC name is N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide.
Molecular Properties
| Compound Name | N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide |
| PubChem CID | 143108414 |
| Molecular Formula | C9H14FNO |
| Molecular Weight | 171.21 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide |
| SMILES | CCC(=O)N/C(C)=C/C=C(\C)F |
| InChI | InChI=1S/C9H14FNO/c1-4-9(12)11-8(3)6-5-7(2)10/h5-6H,4H2,1-3H3,(H,11,12)/b7-5+,8-6+ |
| InChIKey | ZSYCNZXRZQGCFN-KQQUZDAGSA-N |
| XLogP | 2.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide?
The IUPAC name of N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide (CID 143108414) is N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide.
What is the SMILES notation for N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide?
The canonical SMILES for N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide is CCC(=O)N/C(C)=C/C=C(\C)F.
What is the InChIKey of N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide?
The InChIKey is ZSYCNZXRZQGCFN-KQQUZDAGSA-N. The full InChI is InChI=1S/C9H14FNO/c1-4-9(12)11-8(3)6-5-7(2)10/h5-6H,4H2,1-3H3,(H,11,12)/b7-5+,8-6+.
What are the key properties of N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide?
N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide has a molecular weight of 171.21 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]propanamide is sourced from PubChem (CID 143108414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).