C12H22N2O — CID 169113017
3-(dimethylamino)-N-[(2E,4Z)-hepta-2,4-dien-2-yl]propanamide (PubChem CID 169113017) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[(2E,4Z)-hepta-2,4-dien-2-yl]propanamide.
| Compound Name | 3-(dimethylamino)-N-[(2E,4Z)-hepta-2,4-dien-2-yl]propanamide |
|---|---|
| PubChem CID | 169113017 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 3-(dimethylamino)-N-[(2E,4Z)-hepta-2,4-dien-2-yl]propanamide |
| SMILES | CC/C=C\C=C(/C)NC(=O)CCN(C)C |
| InChI | InChI=1S/C12H22N2O/c1-5-6-7-8-11(2)13-12(15)9-10-14(3)4/h6-8H,5,9-10H2,1-4H3,(H,13,15)/b7-6-,11-8+ |
| InChIKey | NXRAKWAAHKQXAQ-BQGCWICQSA-N |
| XLogP | 1.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|