C19H37N3O — CID 176667535
(4E,6Z)-N-[3-[2-[ethyl(methyl)amino]ethyl-methylamino]propyl]-4-methylnona-4,6-dienamide (PubChem CID 176667535) has the molecular formula C19H37N3O and a molecular weight of 323.53 g/mol. Its IUPAC name is (4E,6Z)-N-[3-[2-[ethyl(methyl)amino]ethyl-methylamino]propyl]-4-methylnona-4,6-dienamide.
| Compound Name | (4E,6Z)-N-[3-[2-[ethyl(methyl)amino]ethyl-methylamino]propyl]-4-methylnona-4,6-dienamide |
|---|---|
| PubChem CID | 176667535 |
| Molecular Formula | C19H37N3O |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.29 |
| IUPAC Name | (4E,6Z)-N-[3-[2-[ethyl(methyl)amino]ethyl-methylamino]propyl]-4-methylnona-4,6-dienamide |
| SMILES | CC/C=C\C=C(/C)CCC(=O)NCCCN(C)CCN(C)CC |
| InChI | InChI=1S/C19H37N3O/c1-6-8-9-11-18(3)12-13-19(23)20-14-10-15-22(5)17-16-21(4)7-2/h8-9,11H,6-7,10,12-17H2,1-5H3,(H,20,23)/b9-8-,18-11+ |
| InChIKey | DZQYALDXSJVXQP-YKWGYASXSA-N |
| XLogP | 3.07 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|