C9H16N2O — CID 170752069
N-[(E)-1-ethyliminobut-2-en-2-yl]propanamide (PubChem CID 170752069) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is N-[(E)-1-ethyliminobut-2-en-2-yl]propanamide.
| Compound Name | N-[(E)-1-ethyliminobut-2-en-2-yl]propanamide |
|---|---|
| PubChem CID | 170752069 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-[(E)-1-ethyliminobut-2-en-2-yl]propanamide |
| SMILES | C/C=C(\C=N\CC)NC(=O)CC |
| InChI | InChI=1S/C9H16N2O/c1-4-8(7-10-6-3)11-9(12)5-2/h4,7H,5-6H2,1-3H3,(H,11,12)/b8-4+,10-7+ |
| InChIKey | MZANYPGMEAAXFE-AJQRHIRFSA-N |
| XLogP | 1.51 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|