C11H20NOW- — CID 178102306
ethane;N-[(4Z)-hexa-2,4-dien-3-yl]propanamide;tungsten (PubChem CID 178102306) has the molecular formula C11H20NOW- and a molecular weight of 366.13 g/mol. Its IUPAC name is ethane;N-[(4Z)-hexa-2,4-dien-3-yl]propanamide;tungsten.
| Compound Name | ethane;N-[(4Z)-hexa-2,4-dien-3-yl]propanamide;tungsten |
|---|---|
| PubChem CID | 178102306 |
| Molecular Formula | C11H20NOW- |
| Molecular Weight | 366.13 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | ethane;N-[(4Z)-hexa-2,4-dien-3-yl]propanamide;tungsten |
| SMILES | C/[C-]=C(/C=C\C)NC(=O)CC.CC.[W] |
| InChI | InChI=1S/C9H14NO.C2H6.W/c1-4-7-8(5-2)10-9(11)6-3;1-2;/h4,7H,6H2,1-3H3,(H,10,11);1-2H3;/q-1;;/b7-4-;; |
| InChIKey | RFSRMXSNVGKMLX-XIFWRFGDSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.13 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|