C12H21NO — CID 144641334
ethane;N-[(3E,5Z)-octa-3,5,7-trien-4-yl]acetamide (PubChem CID 144641334) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is ethane;N-[(3E,5Z)-octa-3,5,7-trien-4-yl]acetamide.
| Compound Name | ethane;N-[(3E,5Z)-octa-3,5,7-trien-4-yl]acetamide |
|---|---|
| PubChem CID | 144641334 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | ethane;N-[(3E,5Z)-octa-3,5,7-trien-4-yl]acetamide |
| SMILES | C=C/C=C\C(=C/CC)NC(C)=O.CC |
| InChI | InChI=1S/C10H15NO.C2H6/c1-4-6-8-10(7-5-2)11-9(3)12;1-2/h4,6-8H,1,5H2,2-3H3,(H,11,12);1-2H3/b8-6-,10-7+; |
| InChIKey | NAHOZOJPSJJVQE-AFVXRTLCSA-N |
| XLogP | 3.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|