C17H22O — CID 154692046
(3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene (PubChem CID 154692046) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is (3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene.
| Compound Name | (3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene |
|---|---|
| PubChem CID | 154692046 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene |
| SMILES | C=C/C=C\C(=C/CC)C(C)=O.Cc1ccccc1 |
| InChI | InChI=1S/C10H14O.C7H8/c1-4-6-8-10(7-5-2)9(3)11;1-7-5-3-2-4-6-7/h4,6-8H,1,5H2,2-3H3;2-6H,1H3/b8-6-,10-7+; |
| InChIKey | WPLRSRYLSODTOL-AFVXRTLCSA-N |
| XLogP | 4.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|