About (3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene
(3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene (PubChem CID 154692046) has the molecular formula C17H22O
and a molecular weight of 242.36 g/mol. Its IUPAC name is (3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene.
Molecular Properties
| Compound Name | (3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene |
| PubChem CID | 154692046 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene |
| SMILES | C=C/C=C\C(=C/CC)C(C)=O.Cc1ccccc1 |
| InChI | InChI=1S/C10H14O.C7H8/c1-4-6-8-10(7-5-2)9(3)11;1-7-5-3-2-4-6-7/h4,6-8H,1,5H2,2-3H3;2-6H,1H3/b8-6-,10-7+; |
| InChIKey | WPLRSRYLSODTOL-AFVXRTLCSA-N |
| XLogP | 4.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene?
The IUPAC name of (3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene (CID 154692046) is (3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene.
What is the SMILES notation for (3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene?
The canonical SMILES for (3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene is C=C/C=C\C(=C/CC)C(C)=O.Cc1ccccc1.
What is the InChIKey of (3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene?
The InChIKey is WPLRSRYLSODTOL-AFVXRTLCSA-N. The full InChI is InChI=1S/C10H14O.C7H8/c1-4-6-8-10(7-5-2)9(3)11;1-7-5-3-2-4-6-7/h4,6-8H,1,5H2,2-3H3;2-6H,1H3/b8-6-,10-7+;.
What are the key properties of (3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene?
(3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene has a molecular weight of 242.36 g/mol, XLogP of 4.65, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,4Z)-3-propylidenehepta-4,6-dien-2-one;toluene is sourced from PubChem (CID 154692046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).