C9H14 — CID 123706098
5-methylocta-1,3,5-triene (PubChem CID 123706098) has the molecular formula C9H14 and a molecular weight of 122.21 g/mol. Its IUPAC name is 5-methylocta-1,3,5-triene.
| Compound Name | 5-methylocta-1,3,5-triene |
|---|---|
| PubChem CID | 123706098 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | 5-methylocta-1,3,5-triene |
| SMILES | C=CC=CC(C)=CCC |
| InChI | InChI=1S/C9H14/c1-4-6-8-9(3)7-5-2/h4,6-8H,1,5H2,2-3H3 |
| InChIKey | TUIYJCVQHOAQSO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|