C11H18 — CID 143760343
(3Z,5Z)-5-propan-2-ylocta-1,3,5-triene (PubChem CID 143760343) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is (3Z,5Z)-5-propan-2-ylocta-1,3,5-triene.
| Compound Name | (3Z,5Z)-5-propan-2-ylocta-1,3,5-triene |
|---|---|
| PubChem CID | 143760343 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (3Z,5Z)-5-propan-2-ylocta-1,3,5-triene |
| SMILES | C=C/C=C\C(=C/CC)C(C)C |
| InChI | InChI=1S/C11H18/c1-5-7-9-11(8-6-2)10(3)4/h5,7-10H,1,6H2,2-4H3/b9-7-,11-8+ |
| InChIKey | JHKISXSWZGABCF-BYSFRFKNSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|