C15H32 — CID 144723819
ethane;methane;(3Z,5Z)-5-propan-2-ylhepta-1,3,5-triene (PubChem CID 144723819) has the molecular formula C15H32 and a molecular weight of 212.42 g/mol. Its IUPAC name is ethane;methane;(3Z,5Z)-5-propan-2-ylhepta-1,3,5-triene.
| Compound Name | ethane;methane;(3Z,5Z)-5-propan-2-ylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 144723819 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | ethane;methane;(3Z,5Z)-5-propan-2-ylhepta-1,3,5-triene |
| SMILES | C.C=C/C=C\C(=C/C)C(C)C.CC.CC |
| InChI | InChI=1S/C10H16.2C2H6.CH4/c1-5-7-8-10(6-2)9(3)4;2*1-2;/h5-9H,1H2,2-4H3;2*1-2H3;1H4/b8-7-,10-6+;;; |
| InChIKey | SDCGOPNGCHMDHV-ITAMDNGESA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|