C10H13I — CID 139332360
(3E,5Z)-4-(1-iodoethyl)octa-1,3,5,7-tetraene (PubChem CID 139332360) has the molecular formula C10H13I and a molecular weight of 260.12 g/mol. Its IUPAC name is (3E,5Z)-4-(1-iodoethyl)octa-1,3,5,7-tetraene.
| Compound Name | (3E,5Z)-4-(1-iodoethyl)octa-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 139332360 |
| Molecular Formula | C10H13I |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | (3E,5Z)-4-(1-iodoethyl)octa-1,3,5,7-tetraene |
| SMILES | C=C/C=C\C(=C/C=C)C(C)I |
| InChI | InChI=1S/C10H13I/c1-4-6-8-10(7-5-2)9(3)11/h4-9H,1-2H2,3H3/b8-6-,10-7+ |
| InChIKey | JGCNSSVQWNNPDS-GOOBONSCSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|