C14H25NO2 — CID 144949441
(3E,4Z)-2-amino-3-prop-2-enylidenehepta-4,6-dienal;ethane;methoxymethane (PubChem CID 144949441) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is (3E,4Z)-2-amino-3-prop-2-enylidenehepta-4,6-dienal;ethane;methoxymethane.
| Compound Name | (3E,4Z)-2-amino-3-prop-2-enylidenehepta-4,6-dienal;ethane;methoxymethane |
|---|---|
| PubChem CID | 144949441 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (3E,4Z)-2-amino-3-prop-2-enylidenehepta-4,6-dienal;ethane;methoxymethane |
| SMILES | C=C/C=C\C(=C/C=C)C(N)C=O.CC.COC |
| InChI | InChI=1S/C10H13NO.C2H6O.C2H6/c1-3-5-7-9(6-4-2)10(11)8-12;1-3-2;1-2/h3-8,10H,1-2,11H2;1-2H3;1-2H3/b7-5-,9-6+;; |
| InChIKey | RANDCGYHGARZTL-GZFYBLGYSA-N |
| XLogP | 2.66 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|