C7H13NO — CID 143902044
ethane;(2Z)-penta-2,4-dienamide (PubChem CID 143902044) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is ethane;(2Z)-penta-2,4-dienamide.
| Compound Name | ethane;(2Z)-penta-2,4-dienamide |
|---|---|
| PubChem CID | 143902044 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | ethane;(2Z)-penta-2,4-dienamide |
| SMILES | C=C/C=C\C(N)=O.CC |
| InChI | InChI=1S/C5H7NO.C2H6/c1-2-3-4-5(6)7;1-2/h2-4H,1H2,(H2,6,7);1-2H3/b4-3-; |
| InChIKey | ZRUMPJNBBZWPRF-LNKPDPKZSA-N |
| XLogP | 1.24 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|