C10H13NO — CID 118357992
(2E,4E,5Z)-4-ethylideneocta-2,5,7-trienamide (PubChem CID 118357992) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (2E,4E,5Z)-4-ethylideneocta-2,5,7-trienamide.
| Compound Name | (2E,4E,5Z)-4-ethylideneocta-2,5,7-trienamide |
|---|---|
| PubChem CID | 118357992 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (2E,4E,5Z)-4-ethylideneocta-2,5,7-trienamide |
| SMILES | C=C/C=C\C(\C=C\C(N)=O)=C/C |
| InChI | InChI=1S/C10H13NO/c1-3-5-6-9(4-2)7-8-10(11)12/h3-8H,1H2,2H3,(H2,11,12)/b6-5-,8-7+,9-4+ |
| InChIKey | GSUMVHVZDVGOGN-ARJLVYNQSA-N |
| XLogP | 1.72 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|