C11H14 — CID 143274377
(3Z,5Z)-4-[(E)-prop-1-enyl]octa-1,3,5,7-tetraene (PubChem CID 143274377) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is (3Z,5Z)-4-[(E)-prop-1-enyl]octa-1,3,5,7-tetraene.
| Compound Name | (3Z,5Z)-4-[(E)-prop-1-enyl]octa-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 143274377 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (3Z,5Z)-4-[(E)-prop-1-enyl]octa-1,3,5,7-tetraene |
| SMILES | C=C/C=C\C(=C/C=C)\C=C\C |
| InChI | InChI=1S/C11H14/c1-4-7-10-11(8-5-2)9-6-3/h4-10H,1-2H2,3H3/b9-6+,10-7-,11-8- |
| InChIKey | RSKPPPMTXLGLFH-OBILQVHQSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|