C15H28 — CID 143078245
ethane;(3Z,5Z)-4-[(E)-prop-1-enyl]octa-1,3,5-triene (PubChem CID 143078245) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is ethane;(3Z,5Z)-4-[(E)-prop-1-enyl]octa-1,3,5-triene.
| Compound Name | ethane;(3Z,5Z)-4-[(E)-prop-1-enyl]octa-1,3,5-triene |
|---|---|
| PubChem CID | 143078245 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | ethane;(3Z,5Z)-4-[(E)-prop-1-enyl]octa-1,3,5-triene |
| SMILES | C=C/C=C(\C=C/CC)/C=C/C.CC.CC |
| InChI | InChI=1S/C11H16.2C2H6/c1-4-7-10-11(8-5-2)9-6-3;2*1-2/h5-10H,2,4H2,1,3H3;2*1-2H3/b9-6+,10-7-,11-8-;; |
| InChIKey | UYEJLJFYZKNMLL-NLJFUDLNSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|