C13H26O — CID 142066617
ethane;methoxyethane;(3Z,5Z)-4-methylhepta-1,3,5-triene (PubChem CID 142066617) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is ethane;methoxyethane;(3Z,5Z)-4-methylhepta-1,3,5-triene.
| Compound Name | ethane;methoxyethane;(3Z,5Z)-4-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 142066617 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | ethane;methoxyethane;(3Z,5Z)-4-methylhepta-1,3,5-triene |
| SMILES | C=C/C=C(C)\C=C/C.CC.CCOC |
| InChI | InChI=1S/C8H12.C3H8O.C2H6/c1-4-6-8(3)7-5-2;1-3-4-2;1-2/h4-7H,1H2,2-3H3;3H2,1-2H3;1-2H3/b7-5-,8-6-;; |
| InChIKey | JDCANGDNVIURPU-MNDGBQRHSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|