C7H10O — CID 173388708
3-methylhexa-1,3,5-trien-1-ol (PubChem CID 173388708) has the molecular formula C7H10O and a molecular weight of 110.16 g/mol. Its IUPAC name is 3-methylhexa-1,3,5-trien-1-ol.
| Compound Name | 3-methylhexa-1,3,5-trien-1-ol |
|---|---|
| PubChem CID | 173388708 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | 3-methylhexa-1,3,5-trien-1-ol |
| SMILES | C=CC=C(C)C=CO |
| InChI | InChI=1S/C7H10O/c1-3-4-7(2)5-6-8/h3-6,8H,1H2,2H3 |
| InChIKey | RFPQYTFGNBUAQO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|