C8H11F3 — CID 142106535
fluoroform;(3Z)-3-methylhexa-1,3,5-triene (PubChem CID 142106535) has the molecular formula C8H11F3 and a molecular weight of 164.17 g/mol. Its IUPAC name is fluoroform;(3Z)-3-methylhexa-1,3,5-triene.
| Compound Name | fluoroform;(3Z)-3-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 142106535 |
| Molecular Formula | C8H11F3 |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | fluoroform;(3Z)-3-methylhexa-1,3,5-triene |
| SMILES | C=C/C=C(/C)C=C.FC(F)F |
| InChI | InChI=1S/C7H10.CHF3/c1-4-6-7(3)5-2;2-1(3)4/h4-6H,1-2H2,3H3;1H/b7-6-; |
| InChIKey | PFCCSRCEYJHDNV-NAFXZHHSSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|